C20H12FN3O3S2 — CID 3114905
N-[3-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-2-fluorobenzamide (PubChem CID 3114905) has the molecular formula C20H12FN3O3S2 and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-2-fluorobenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3114905 |
| Molecular Formula | C20H12FN3O3S2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cc(Sc2nc3ccccc3s2)cc([N+](=O)[O-])c1)c1ccccc1F |
| InChI | InChI=1S/C20H12FN3O3S2/c21-16-6-2-1-5-15(16)19(25)22-12-9-13(24(26)27)11-14(10-12)28-20-23-17-7-3-4-8-18(17)29-20/h1-11H,(H,22,25) |
| InChIKey | VSIRHCUECHYOBG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|