C24H14ClN3O4S — CID 2911609
N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 2911609) has the molecular formula C24H14ClN3O4S and a molecular weight of 475.91 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2911609 |
| Molecular Formula | C24H14ClN3O4S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2nc3ccccc3s2)ccc1Cl)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C24H14ClN3O4S/c25-16-10-9-14(24-27-17-6-2-4-8-22(17)33-24)13-18(16)26-23(29)21-12-11-20(32-21)15-5-1-3-7-19(15)28(30)31/h1-13H,(H,26,29) |
| InChIKey | UHNAAARFUVVXGS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|