C21H13ClFN3O3S — CID 71605905
N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-4-fluoro-5-nitrobenzamide (PubChem CID 71605905) has the molecular formula C21H13ClFN3O3S and a molecular weight of 441.87 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-4-fluoro-5-nitrobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-4-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 71605905 |
| Molecular Formula | C21H13ClFN3O3S |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-4-fluoro-5-nitrobenzamide |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)cc1NC(=O)c1cc([N+](=O)[O-])c(F)cc1Cl |
| InChI | InChI=1S/C21H13ClFN3O3S/c1-11-6-7-12(21-25-16-4-2-3-5-19(16)30-21)8-17(11)24-20(27)13-9-18(26(28)29)15(23)10-14(13)22/h2-10H,1H3,(H,24,27) |
| InChIKey | POYPOHQOPZZBJY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|