C21H14ClIN2OS — CID 17116673
N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-5-iodobenzamide (PubChem CID 17116673) has the molecular formula C21H14ClIN2OS and a molecular weight of 504.78 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-5-iodobenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-5-iodobenzamide |
|---|---|
| PubChem CID | 17116673 |
| Molecular Formula | C21H14ClIN2OS |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-2-chloro-5-iodobenzamide |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NC(=O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C21H14ClIN2OS/c1-12-10-13(21-25-18-4-2-3-5-19(18)27-21)6-9-17(12)24-20(26)15-11-14(23)7-8-16(15)22/h2-11H,1H3,(H,24,26) |
| InChIKey | PFIVMEBYDKPIES-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|