C21H16ClN3OS — CID 46381200
1-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-3-(3-chlorophenyl)urea (PubChem CID 46381200) has the molecular formula C21H16ClN3OS and a molecular weight of 393.90 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 46381200 |
| Molecular Formula | C21H16ClN3OS |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-3-(3-chlorophenyl)urea |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClN3OS/c1-13-11-14(20-24-18-7-2-3-8-19(18)27-20)9-10-17(13)25-21(26)23-16-6-4-5-15(22)12-16/h2-12H,1H3,(H2,23,25,26) |
| InChIKey | DVZFGDKFAZWXQF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |