C24H18ClN3O6S — CID 71606409
ethyl 2-[4-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamoyl]-5-chloro-2-nitrophenoxy]acetate (PubChem CID 71606409) has the molecular formula C24H18ClN3O6S and a molecular weight of 511.94 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamoyl]-5-chloro-2-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamoyl]-5-chloro-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 71606409 |
| Molecular Formula | C24H18ClN3O6S |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | ethyl 2-[4-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamoyl]-5-chloro-2-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Cl)c(C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18ClN3O6S/c1-2-33-22(29)13-34-20-12-17(25)16(11-19(20)28(31)32)23(30)26-15-7-5-6-14(10-15)24-27-18-8-3-4-9-21(18)35-24/h3-12H,2,13H2,1H3,(H,26,30) |
| InChIKey | VVXXTOASQWPXMH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|