C18H13N5OS — CID 34290939
3-amino-N-[3-(1,3-benzothiazol-2-yl)phenyl]pyrazine-2-carboxamide (PubChem CID 34290939) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-amino-N-[3-(1,3-benzothiazol-2-yl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[3-(1,3-benzothiazol-2-yl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 34290939 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 3-amino-N-[3-(1,3-benzothiazol-2-yl)phenyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H13N5OS/c19-16-15(20-8-9-21-16)17(24)22-12-5-3-4-11(10-12)18-23-13-6-1-2-7-14(13)25-18/h1-10H,(H2,19,21)(H,22,24) |
| InChIKey | LCYDYAPAMFUKFX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |