C23H20N4O2S — CID 9456512
N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide (PubChem CID 9456512) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 9456512 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-morpholin-4-ylpyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3s2)c1)c1cc(N2CCOCC2)ccn1 |
| InChI | InChI=1S/C23H20N4O2S/c28-22(20-15-18(8-9-24-20)27-10-12-29-13-11-27)25-17-5-3-4-16(14-17)23-26-19-6-1-2-7-21(19)30-23/h1-9,14-15H,10-13H2,(H,25,28) |
| InChIKey | DOEYFAXOTNSOOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |