C20H12ClIN2OS — CID 70815255
N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-chloro-6-iodobenzamide (PubChem CID 70815255) has the molecular formula C20H12ClIN2OS and a molecular weight of 490.75 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-chloro-6-iodobenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-chloro-6-iodobenzamide |
|---|---|
| PubChem CID | 70815255 |
| Molecular Formula | C20H12ClIN2OS |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 489.94 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-chloro-6-iodobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3s2)c1)c1c(Cl)cccc1I |
| InChI | InChI=1S/C20H12ClIN2OS/c21-14-7-4-8-15(22)18(14)19(25)23-13-6-3-5-12(11-13)20-24-16-9-1-2-10-17(16)26-20/h1-11H,(H,23,25) |
| InChIKey | YPYKEJCQHLDADP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|