C22H18N2S — CID 2202917
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(3-methylphenyl)methanimine (PubChem CID 2202917) has the molecular formula C22H18N2S and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(3-methylphenyl)methanimine.
| Compound Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 2202917 |
| Molecular Formula | C22H18N2S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(3-methylphenyl)methanimine |
| SMILES | Cc1cccc(/C=N/c2ccc(-c3nc4ccc(C)cc4s3)cc2)c1 |
| InChI | InChI=1S/C22H18N2S/c1-15-4-3-5-17(12-15)14-23-19-9-7-18(8-10-19)22-24-20-11-6-16(2)13-21(20)25-22/h3-14H,1-2H3/b23-14+ |
| InChIKey | RDANXPSBTSMCAV-OEAKJJBVSA-N |
| XLogP | 6.33 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|