C21H14BrClN2OS — CID 3877660
2-bromo-4-chloro-6-[[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 3877660) has the molecular formula C21H14BrClN2OS and a molecular weight of 457.78 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3877660 |
| Molecular Formula | C21H14BrClN2OS |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | 2-bromo-4-chloro-6-[[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Cc1ccc2sc(-c3ccc(/N=C/c4cc(Cl)cc(Br)c4O)cc3)nc2c1 |
| InChI | InChI=1S/C21H14BrClN2OS/c1-12-2-7-19-18(8-12)25-21(27-19)13-3-5-16(6-4-13)24-11-14-9-15(23)10-17(22)20(14)26/h2-11,26H,1H3/b24-11+ |
| InChIKey | HXIADXKSJAXUCY-BHGWPJFGSA-N |
| XLogP | 7.14 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|