C14H11NOS — CID 43306267
3-(5-methyl-1,3-benzothiazol-2-yl)phenol (PubChem CID 43306267) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-(5-methyl-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 3-(5-methyl-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 43306267 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(5-methyl-1,3-benzothiazol-2-yl)phenol |
| SMILES | Cc1ccc2sc(-c3cccc(O)c3)nc2c1 |
| InChI | InChI=1S/C14H11NOS/c1-9-5-6-13-12(7-9)15-14(17-13)10-3-2-4-11(16)8-10/h2-8,16H,1H3 |
| InChIKey | BANGFHGBNWKRIX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |