C24H22N2S — CID 25212461
N,N-dimethyl-4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]aniline (PubChem CID 25212461) has the molecular formula C24H22N2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 25212461 |
| Molecular Formula | C24H22N2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]aniline |
| SMILES | Cc1ccc2nc(-c3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C24H22N2S/c1-17-4-15-22-23(16-17)27-24(25-22)20-11-7-18(8-12-20)5-6-19-9-13-21(14-10-19)26(2)3/h4-16H,1-3H3/b6-5+ |
| InChIKey | DFQHNRAIEXCYOS-AATRIKPKSA-N |
| XLogP | 6.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|