C22H16NNaO3S2 — CID 58342191
sodium 4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]benzenesulfonate (PubChem CID 58342191) has the molecular formula C22H16NNaO3S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is sodium 4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]benzenesulfonate.
| Compound Name | sodium 4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 58342191 |
| Molecular Formula | C22H16NNaO3S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | sodium 4-[(E)-2-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]ethenyl]benzenesulfonate |
| SMILES | Cc1ccc2nc(-c3ccc(/C=C/c4ccc(S(=O)(=O)[O-])cc4)cc3)sc2c1.[Na+] |
| InChI | InChI=1S/C22H17NO3S2.Na/c1-15-2-13-20-21(14-15)27-22(23-20)18-9-5-16(6-10-18)3-4-17-7-11-19(12-8-17)28(24,25)26;/h2-14H,1H3,(H,24,25,26);/q;+1/p-1/b4-3+; |
| InChIKey | BWZPXBUKOMGPKL-BJILWQEISA-M |
| XLogP | 2.35 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|