C25H21F3N2OS — CID 174730845
2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(3,3,3-trifluoropropyl)aniline (PubChem CID 174730845) has the molecular formula C25H21F3N2OS and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 174730845 |
| Molecular Formula | C25H21F3N2OS |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(3,3,3-trifluoropropyl)aniline |
| SMILES | COc1ccc2nc(-c3ccc(C=Cc4ccc(CCC(F)(F)F)cc4N)cc3)sc2c1 |
| InChI | InChI=1S/C25H21F3N2OS/c1-31-20-10-11-22-23(15-20)32-24(30-22)19-8-3-16(4-9-19)2-6-18-7-5-17(14-21(18)29)12-13-25(26,27)28/h2-11,14-15H,12-13,29H2,1H3 |
| InChIKey | QSFIMFJHRFWVGA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|