C24H27N3OS2 — CID 4934365
3-cyclohexyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide (PubChem CID 4934365) has the molecular formula C24H27N3OS2 and a molecular weight of 437.63 g/mol. Its IUPAC name is 3-cyclohexyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 4934365 |
| Molecular Formula | C24H27N3OS2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-cyclohexyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]propanamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)CCC4CCCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C24H27N3OS2/c1-16-7-13-20-21(15-16)30-23(26-20)18-9-11-19(12-10-18)25-24(29)27-22(28)14-8-17-5-3-2-4-6-17/h7,9-13,15,17H,2-6,8,14H2,1H3,(H2,25,27,28,29) |
| InChIKey | KHNNDNUECKJZEV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|