C22H16BrN3OS2 — CID 2279287
3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 2279287) has the molecular formula C22H16BrN3OS2 and a molecular weight of 482.43 g/mol. Its IUPAC name is 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2279287 |
| Molecular Formula | C22H16BrN3OS2 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)c4cccc(Br)c4)cc3)sc2c1 |
| InChI | InChI=1S/C22H16BrN3OS2/c1-13-5-10-18-19(11-13)29-21(25-18)14-6-8-17(9-7-14)24-22(28)26-20(27)15-3-2-4-16(23)12-15/h2-12H,1H3,(H2,24,26,27,28) |
| InChIKey | GIYYIQNOBVJZOJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|