C27H26BrN3O2S2 — CID 17339674
3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17339674) has the molecular formula C27H26BrN3O2S2 and a molecular weight of 568.56 g/mol. Its IUPAC name is 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339674 |
| Molecular Formula | C27H26BrN3O2S2 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | 3-bromo-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)c4ccc(OCCC(C)C)c(Br)c4)cc3)sc2c1 |
| InChI | InChI=1S/C27H26BrN3O2S2/c1-16(2)12-13-33-23-11-7-19(15-21(23)28)25(32)31-27(34)29-20-8-5-18(6-9-20)26-30-22-10-4-17(3)14-24(22)35-26/h4-11,14-16H,12-13H2,1-3H3,(H2,29,31,32,34) |
| InChIKey | XLPSMEDBUHLDCC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|