C18H16BrN3O2S2 — CID 1048280
3-bromo-4-ethoxy-N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 1048280) has the molecular formula C18H16BrN3O2S2 and a molecular weight of 450.38 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1048280 |
| Molecular Formula | C18H16BrN3O2S2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2nc3ccc(C)cc3s2)cc1Br |
| InChI | InChI=1S/C18H16BrN3O2S2/c1-3-24-14-7-5-11(9-12(14)19)16(23)21-17(25)22-18-20-13-6-4-10(2)8-15(13)26-18/h4-9H,3H2,1-2H3,(H2,20,21,22,23,25) |
| InChIKey | NLGIITIUYDHOCR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|