C16H15Br2N3O2S — CID 4509618
3-bromo-N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-4-ethoxybenzamide (PubChem CID 4509618) has the molecular formula C16H15Br2N3O2S and a molecular weight of 473.19 g/mol. Its IUPAC name is 3-bromo-N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-4-ethoxybenzamide.
| Compound Name | 3-bromo-N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 4509618 |
| Molecular Formula | C16H15Br2N3O2S |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 3-bromo-N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(Br)c(C)n2)cc1Br |
| InChI | InChI=1S/C16H15Br2N3O2S/c1-3-23-13-6-4-10(8-12(13)18)15(22)21-16(24)20-14-7-5-11(17)9(2)19-14/h4-8H,3H2,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | CEABYWYOLRPVTN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|