C17H13BrCl2N2O4S — CID 3282679
2-[(3-bromo-4-ethoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid (PubChem CID 3282679) has the molecular formula C17H13BrCl2N2O4S and a molecular weight of 492.18 g/mol. Its IUPAC name is 2-[(3-bromo-4-ethoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 2-[(3-bromo-4-ethoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 3282679 |
| Molecular Formula | C17H13BrCl2N2O4S |
| Molecular Weight | 492.18 g/mol |
| Exact Mass | 489.92 |
| IUPAC Name | 2-[(3-bromo-4-ethoxybenzoyl)carbamothioylamino]-3,5-dichlorobenzoic acid |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2c(Cl)cc(Cl)cc2C(=O)O)cc1Br |
| InChI | InChI=1S/C17H13BrCl2N2O4S/c1-2-26-13-4-3-8(5-11(13)18)15(23)22-17(27)21-14-10(16(24)25)6-9(19)7-12(14)20/h3-7H,2H2,1H3,(H,24,25)(H2,21,22,23,27) |
| InChIKey | HRGMTHRPUDJLIX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.18 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|