C15H13BrClN3O2S — CID 1289437
N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-3-chloro-4-methoxybenzamide (PubChem CID 1289437) has the molecular formula C15H13BrClN3O2S and a molecular weight of 414.71 g/mol. Its IUPAC name is N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-3-chloro-4-methoxybenzamide.
| Compound Name | N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-3-chloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 1289437 |
| Molecular Formula | C15H13BrClN3O2S |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-[(5-bromo-6-methyl-2-pyridinyl)carbamothioyl]-3-chloro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(Br)c(C)n2)cc1Cl |
| InChI | InChI=1S/C15H13BrClN3O2S/c1-8-10(16)4-6-13(18-8)19-15(23)20-14(21)9-3-5-12(22-2)11(17)7-9/h3-7H,1-2H3,(H2,18,19,20,21,23) |
| InChIKey | WHEIIMHCBRBPMJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|