C19H23IN2O2S2 — CID 144970959
ethane;3-[[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]oxy]propoxy thiohypoiodite (PubChem CID 144970959) has the molecular formula C19H23IN2O2S2 and a molecular weight of 502.44 g/mol. Its IUPAC name is ethane;3-[[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]oxy]propoxy thiohypoiodite.
| Compound Name | ethane;3-[[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]oxy]propoxy thiohypoiodite |
|---|---|
| PubChem CID | 144970959 |
| Molecular Formula | C19H23IN2O2S2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | ethane;3-[[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]oxy]propoxy thiohypoiodite |
| SMILES | CC.CNc1ccc(-c2nc3ccc(OCCCOSI)cc3s2)cc1 |
| InChI | InChI=1S/C17H17IN2O2S2.C2H6/c1-19-13-5-3-12(4-6-13)17-20-15-8-7-14(11-16(15)23-17)21-9-2-10-22-24-18;1-2/h3-8,11,19H,2,9-10H2,1H3;1-2H3 |
| InChIKey | JWIPGAFBBHYSAR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|