C14H11FN2OS — CID 135610914
3-fluoro-4-[6-(methylamino)-1,3-benzothiazol-2-yl]phenol (PubChem CID 135610914) has the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-fluoro-4-[6-(methylamino)-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 3-fluoro-4-[6-(methylamino)-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135610914 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-fluoro-4-[6-(methylamino)-1,3-benzothiazol-2-yl]phenol |
| SMILES | CNc1ccc2nc(-c3ccc(O)cc3F)sc2c1 |
| InChI | InChI=1S/C14H11FN2OS/c1-16-8-2-5-12-13(6-8)19-14(17-12)10-4-3-9(18)7-11(10)15/h2-7,16,18H,1H3 |
| InChIKey | SSHWAWJKKZZELW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |