C15H15N3OS — CID 142943061
N-[2-[3-methyl-4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]hydroxylamine (PubChem CID 142943061) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[2-[3-methyl-4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]hydroxylamine.
| Compound Name | N-[2-[3-methyl-4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]hydroxylamine |
|---|---|
| PubChem CID | 142943061 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[2-[3-methyl-4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]hydroxylamine |
| SMILES | CNc1ccc(-c2nc3ccc(NO)cc3s2)cc1C |
| InChI | InChI=1S/C15H15N3OS/c1-9-7-10(3-5-12(9)16-2)15-17-13-6-4-11(18-19)8-14(13)20-15/h3-8,16,18-19H,1-2H3 |
| InChIKey | IYGQHDJBYBOTOQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|