C14H11N2NaO3S2 — CID 23710157
sodium N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]sulfamate (PubChem CID 23710157) has the molecular formula C14H11N2NaO3S2 and a molecular weight of 342.38 g/mol. Its IUPAC name is sodium N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]sulfamate.
| Compound Name | sodium N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]sulfamate |
|---|---|
| PubChem CID | 23710157 |
| Molecular Formula | C14H11N2NaO3S2 |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | sodium N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]sulfamate |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H12N2O3S2.Na/c1-9-8-10(6-7-11(9)16-21(17,18)19)14-15-12-4-2-3-5-13(12)20-14;/h2-8,16H,1H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | KGEDMZUXMXUVPA-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|