C21H15N3O2S2 — CID 46392586
N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-cyanobenzenesulfonamide (PubChem CID 46392586) has the molecular formula C21H15N3O2S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-cyanobenzenesulfonamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 46392586 |
| Molecular Formula | C21H15N3O2S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-4-cyanobenzenesulfonamide |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H15N3O2S2/c1-14-12-16(21-23-19-4-2-3-5-20(19)27-21)8-11-18(14)24-28(25,26)17-9-6-15(13-22)7-10-17/h2-12,24H,1H3 |
| InChIKey | JMFHSUODNZZLLS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |