C17H14N4O2S2 — CID 46392593
N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-1H-imidazole-5-sulfonamide (PubChem CID 46392593) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 46392593 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-2-methylphenyl]-1H-imidazole-5-sulfonamide |
| SMILES | Cc1cc(-c2nc3ccccc3s2)ccc1NS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C17H14N4O2S2/c1-11-8-12(17-20-14-4-2-3-5-15(14)24-17)6-7-13(11)21-25(22,23)16-9-18-10-19-16/h2-10,21H,1H3,(H,18,19) |
| InChIKey | GXTSOOQOVPAXMA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |