C23H20N2O2S2 — CID 166934660
methyl 3-[[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]sulfanylmethyl]benzoate (PubChem CID 166934660) has the molecular formula C23H20N2O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is methyl 3-[[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 166934660 |
| Molecular Formula | C23H20N2O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | methyl 3-[[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(CSNc2ccc(-c3nc4ccc(C)cc4s3)cc2)c1 |
| InChI | InChI=1S/C23H20N2O2S2/c1-15-6-11-20-21(12-15)29-22(24-20)17-7-9-19(10-8-17)25-28-14-16-4-3-5-18(13-16)23(26)27-2/h3-13,25H,14H2,1-2H3 |
| InChIKey | DEPGZWPIGLTARS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|