C20H15N3O2S2 — CID 166934701
4-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-nitrophenyl)sulfanylaniline (PubChem CID 166934701) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-nitrophenyl)sulfanylaniline.
| Compound Name | 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-nitrophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 166934701 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-nitrophenyl)sulfanylaniline |
| SMILES | Cc1ccc2nc(-c3ccc(NSc4cccc([N+](=O)[O-])c4)cc3)sc2c1 |
| InChI | InChI=1S/C20H15N3O2S2/c1-13-5-10-18-19(11-13)26-20(21-18)14-6-8-15(9-7-14)22-27-17-4-2-3-16(12-17)23(24)25/h2-12,22H,1H3 |
| InChIKey | FMOTWINKYBTDEE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|