C24H16ClN5O3S — CID 108853881
(Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide (PubChem CID 108853881) has the molecular formula C24H16ClN5O3S and a molecular weight of 489.94 g/mol. Its IUPAC name is (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide.
| Compound Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108853881 |
| Molecular Formula | C24H16ClN5O3S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | (Z)-N-(2-chloro-5-nitrophenyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide |
| SMILES | Cc1ccc2nc(-c3ccc(N/C=C(/C#N)C(=O)Nc4cc([N+](=O)[O-])ccc4Cl)cc3)sc2c1 |
| InChI | InChI=1S/C24H16ClN5O3S/c1-14-2-9-20-22(10-14)34-24(29-20)15-3-5-17(6-4-15)27-13-16(12-26)23(31)28-21-11-18(30(32)33)7-8-19(21)25/h2-11,13,27H,1H3,(H,28,31)/b16-13- |
| InChIKey | IMEOEMGTICGSEQ-SSZFMOIBSA-N |
| XLogP | 6.29 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|