C23H23N5OS — CID 108862038
(Z)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 108862038) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is (Z)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108862038 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (Z)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-(4-methylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(-c3ccc(N/C=C(/C#N)C(=O)N4CCN(C)CC4)cc3)sc2c1 |
| InChI | InChI=1S/C23H23N5OS/c1-16-3-8-20-21(13-16)30-22(26-20)17-4-6-19(7-5-17)25-15-18(14-24)23(29)28-11-9-27(2)10-12-28/h3-8,13,15,25H,9-12H2,1-2H3/b18-15- |
| InChIKey | ZXLVVWNQVVGCAY-SDXDJHTJSA-N |
| XLogP | 3.87 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|