C29H27N5OS — CID 108861665
(Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enenitrile (PubChem CID 108861665) has the molecular formula C29H27N5OS and a molecular weight of 493.64 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108861665 |
| Molecular Formula | C29H27N5OS |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (Z)-2-(4-benzylpiperazine-1-carbonyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enenitrile |
| SMILES | Cc1ccc2nc(-c3ccc(N/C=C(/C#N)C(=O)N4CCN(Cc5ccccc5)CC4)cc3)sc2c1 |
| InChI | InChI=1S/C29H27N5OS/c1-21-7-12-26-27(17-21)36-28(32-26)23-8-10-25(11-9-23)31-19-24(18-30)29(35)34-15-13-33(14-16-34)20-22-5-3-2-4-6-22/h2-12,17,19,31H,13-16,20H2,1H3/b24-19- |
| InChIKey | WRWNRAVQENTSCN-CLCOLTQESA-N |
| XLogP | 5.44 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|