C20H17ClN4OS — CID 108854627
(Z)-N-(2-chloroethyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide (PubChem CID 108854627) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is (Z)-N-(2-chloroethyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide.
| Compound Name | (Z)-N-(2-chloroethyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108854627 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (Z)-N-(2-chloroethyl)-2-cyano-3-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]prop-2-enamide |
| SMILES | Cc1ccc2nc(-c3ccc(N/C=C(/C#N)C(=O)NCCCl)cc3)sc2c1 |
| InChI | InChI=1S/C20H17ClN4OS/c1-13-2-7-17-18(10-13)27-20(25-17)14-3-5-16(6-4-14)24-12-15(11-22)19(26)23-9-8-21/h2-7,10,12,24H,8-9H2,1H3,(H,23,26)/b15-12- |
| InChIKey | QBWKZNFUYBQJRY-QINSGFPZSA-N |
| XLogP | 4.45 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|