C14H15NO2S — CID 79036936
methyl 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzoate (PubChem CID 79036936) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is methyl 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzoate.
| Compound Name | methyl 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 79036936 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzoate |
| SMILES | CCc1nc(-c2cccc(C(=O)OC)c2)sc1C |
| InChI | InChI=1S/C14H15NO2S/c1-4-12-9(2)18-13(15-12)10-6-5-7-11(8-10)14(16)17-3/h5-8H,4H2,1-3H3 |
| InChIKey | LDIZIRCMWVWRMN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |