C15H15NO2S — CID 80556455
methyl 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzoate (PubChem CID 80556455) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is methyl 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzoate.
| Compound Name | methyl 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 80556455 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl 3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2nc3c(s2)CCCC3)c1 |
| InChI | InChI=1S/C15H15NO2S/c1-18-15(17)11-6-4-5-10(9-11)14-16-12-7-2-3-8-13(12)19-14/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | NWWIODWOLUOMQI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |