C14H13ClN2O2S — CID 21313579
3-(5-acetamido-4-ethyl-1,3-thiazol-2-yl)benzoyl chloride (PubChem CID 21313579) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is 3-(5-acetamido-4-ethyl-1,3-thiazol-2-yl)benzoyl chloride.
| Compound Name | 3-(5-acetamido-4-ethyl-1,3-thiazol-2-yl)benzoyl chloride |
|---|---|
| PubChem CID | 21313579 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-(5-acetamido-4-ethyl-1,3-thiazol-2-yl)benzoyl chloride |
| SMILES | CCc1nc(-c2cccc(C(=O)Cl)c2)sc1NC(C)=O |
| InChI | InChI=1S/C14H13ClN2O2S/c1-3-11-14(16-8(2)18)20-13(17-11)10-6-4-5-9(7-10)12(15)19/h4-7H,3H2,1-2H3,(H,16,18) |
| InChIKey | UYCQKPDEGJKYQI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|