C14H16N2O2S — CID 104840726
ethyl 2-(3-aminophenyl)-4-ethyl-1,3-thiazole-5-carboxylate (PubChem CID 104840726) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is ethyl 2-(3-aminophenyl)-4-ethyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(3-aminophenyl)-4-ethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 104840726 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | ethyl 2-(3-aminophenyl)-4-ethyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cccc(N)c2)nc1CC |
| InChI | InChI=1S/C14H16N2O2S/c1-3-11-12(14(17)18-4-2)19-13(16-11)9-6-5-7-10(15)8-9/h5-8H,3-4,15H2,1-2H3 |
| InChIKey | YTAHWJPLSOGTAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|