C13H14N2O2S — CID 83777894
ethyl 5-amino-2-(3-methylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 83777894) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 5-amino-2-(3-methylphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-amino-2-(3-methylphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 83777894 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl 5-amino-2-(3-methylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccc(C)c2)sc1N |
| InChI | InChI=1S/C13H14N2O2S/c1-3-17-13(16)10-11(14)18-12(15-10)9-6-4-5-8(2)7-9/h4-7H,3,14H2,1-2H3 |
| InChIKey | YCCILWXPZZHKFG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |