C16H19NO3S — CID 116526130
ethyl 5-methyl-2-(3-propoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 116526130) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 5-methyl-2-(3-propoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-(3-propoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 116526130 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | ethyl 5-methyl-2-(3-propoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCCOc1cccc(-c2nc(C(=O)OCC)c(C)s2)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-4-9-20-13-8-6-7-12(10-13)15-17-14(11(3)21-15)16(18)19-5-2/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | CTIMDGJFIJOZQG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |