C13H12BrNO2S — CID 131867355
ethyl 2-bromo-4-(3-methylphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 131867355) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is ethyl 2-bromo-4-(3-methylphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-bromo-4-(3-methylphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 131867355 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | ethyl 2-bromo-4-(3-methylphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Br)nc1-c1cccc(C)c1 |
| InChI | InChI=1S/C13H12BrNO2S/c1-3-17-12(16)11-10(15-13(14)18-11)9-6-4-5-8(2)7-9/h4-7H,3H2,1-2H3 |
| InChIKey | PHGWOBYBPBESNV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |