C14H16N2O2S — CID 90477363
ethyl 2-amino-4-(3,4-dimethylphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 90477363) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is ethyl 2-amino-4-(3,4-dimethylphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-amino-4-(3,4-dimethylphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 90477363 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | ethyl 2-amino-4-(3,4-dimethylphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N)nc1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H16N2O2S/c1-4-18-13(17)12-11(16-14(15)19-12)10-6-5-8(2)9(3)7-10/h5-7H,4H2,1-3H3,(H2,15,16) |
| InChIKey | KQAOGJHFMVEYJB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |