C7H8N2O3S — CID 59864685
ethyl 2-amino-4-formyl-1,3-thiazole-5-carboxylate (PubChem CID 59864685) has the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. Its IUPAC name is ethyl 2-amino-4-formyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-amino-4-formyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59864685 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | ethyl 2-amino-4-formyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N)nc1C=O |
| InChI | InChI=1S/C7H8N2O3S/c1-2-12-6(11)5-4(3-10)9-7(8)13-5/h3H,2H2,1H3,(H2,8,9) |
| InChIKey | SMBNNIICTSBLKB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|