C12H12O3S2 — CID 101246792
ethyl 2-formyl-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate (PubChem CID 101246792) has the molecular formula C12H12O3S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is ethyl 2-formyl-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate.
| Compound Name | ethyl 2-formyl-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 101246792 |
| Molecular Formula | C12H12O3S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | ethyl 2-formyl-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CCOC(=O)c1sc2sc(C=O)c(C)c2c1C |
| InChI | InChI=1S/C12H12O3S2/c1-4-15-11(14)10-7(3)9-6(2)8(5-13)16-12(9)17-10/h5H,4H2,1-3H3 |
| InChIKey | HLPWNZOUVBWYMK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|