C13H14O3S — CID 155577564
ethyl 4-methoxy-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 155577564) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 4-methoxy-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4-methoxy-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 155577564 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | ethyl 4-methoxy-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(OC)c2c1C |
| InChI | InChI=1S/C13H14O3S/c1-4-16-13(14)12-8(2)11-9(15-3)6-5-7-10(11)17-12/h5-7H,4H2,1-3H3 |
| InChIKey | CWYDFWSBNVGAAW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |