C14H15BrO3S — CID 152677428
ethyl 3-(bromomethyl)-4-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 152677428) has the molecular formula C14H15BrO3S and a molecular weight of 343.24 g/mol. Its IUPAC name is ethyl 3-(bromomethyl)-4-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-(bromomethyl)-4-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 152677428 |
| Molecular Formula | C14H15BrO3S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | ethyl 3-(bromomethyl)-4-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(COC)c2c1CBr |
| InChI | InChI=1S/C14H15BrO3S/c1-3-18-14(16)13-10(7-15)12-9(8-17-2)5-4-6-11(12)19-13/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | ZMUUFKVCSMTZJX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|