C19H17FO3S — CID 7736124
(2-methylphenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 7736124) has the molecular formula C19H17FO3S and a molecular weight of 344.41 g/mol. Its IUPAC name is (2-methylphenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | (2-methylphenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7736124 |
| Molecular Formula | C19H17FO3S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (2-methylphenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | COCc1c(C(=O)OCc2ccccc2C)sc2cccc(F)c12 |
| InChI | InChI=1S/C19H17FO3S/c1-12-6-3-4-7-13(12)10-23-19(21)18-14(11-22-2)17-15(20)8-5-9-16(17)24-18/h3-9H,10-11H2,1-2H3 |
| InChIKey | MTWDATBBCBUHGU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |