C14H15FO3S — CID 55475379
propan-2-yl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 55475379) has the molecular formula C14H15FO3S and a molecular weight of 282.34 g/mol. Its IUPAC name is propan-2-yl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | propan-2-yl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55475379 |
| Molecular Formula | C14H15FO3S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | propan-2-yl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | COCc1c(C(=O)OC(C)C)sc2cccc(F)c12 |
| InChI | InChI=1S/C14H15FO3S/c1-8(2)18-14(16)13-9(7-17-3)12-10(15)5-4-6-11(12)19-13/h4-6,8H,7H2,1-3H3 |
| InChIKey | CGKTXZWMBUEVSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |