C14H14FNO2S — CID 134015607
azetidin-1-yl-[4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]methanone (PubChem CID 134015607) has the molecular formula C14H14FNO2S and a molecular weight of 279.34 g/mol. Its IUPAC name is azetidin-1-yl-[4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]methanone.
| Compound Name | azetidin-1-yl-[4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 134015607 |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | azetidin-1-yl-[4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]methanone |
| SMILES | COCc1c(C(=O)N2CCC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C14H14FNO2S/c1-18-8-9-12-10(15)4-2-5-11(12)19-13(9)14(17)16-6-3-7-16/h2,4-5H,3,6-8H2,1H3 |
| InChIKey | GZEGZEQFJGBZNW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |