C15H16FNO2S2 — CID 56813503
[4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 56813503) has the molecular formula C15H16FNO2S2 and a molecular weight of 325.43 g/mol. Its IUPAC name is [4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 56813503 |
| Molecular Formula | C15H16FNO2S2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [4-fluoro-3-(methoxymethyl)-1-benzothiophen-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | COCc1c(C(=O)N2CCSCC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C15H16FNO2S2/c1-19-9-10-13-11(16)3-2-4-12(13)21-14(10)15(18)17-5-7-20-8-6-17/h2-4H,5-9H2,1H3 |
| InChIKey | PLNWOAZETYLIEB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |